| MolName | (Z)-N-[4-(9H-fluoren-9-yl)piperazin-1-yl]-1-(4-fluorophenyl)methanimine |
| MolecularFormula | C24H22N3F |
| Smiles | Fc1ccc(/C=N\N(CC2)CCN2C2c(cccc3)c3-c3c2cccc3)cc1 |
| InChI | InChI=1S/C24H22FN3/c25-19-11-9-18(10-12-19)17-26-28-15-13-27(14-16-28)24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24/h1-12,17,24H,13-16H2 |
| InChIK | XNQSWLMNTBLBQH-UHFFFAOYSA-N |
| TotalMolweight | 371.458 |
| Molweight | 371.458 |
| MonoisotopicMass | 371.179775 |
| CLogP | 5.0096 |
| CLogS | -5.23 |
| H Acceptors | 3 |
| TotalSurfaceArea | 285.03 |
| Relative PSA | 0.065291 |
| PolarSurfaceArea | 18.84 |
| Druglikeness | 5.626 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 10 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-(9H-fluoren-9-yl)piperazin-1-yl]-1-(4-fluorophenyl)methanimine | 2 - (Z)-N-[4-(9H-fluoren-9-yl)piperazin-1-yl]-1-(4-fluorophenyl)methanimine