| MolName | N-[2-oxo-2-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]ethyl]-3-phenylpropanamide |
| MolecularFormula | C17H18N4O2 |
| Smiles | O=C(CCc1ccccc1)NCC(N/N=C\c1cnccc1)=O |
| InChI | InChI=1S/C17H18N4O2/c22-16(9-8-14-5-2-1-3-6-14)19-13-17(23)21-20-12-15-7-4-10-18-11-15/h1-7,10-12H,8-9,13H2,(H,19,22)(H,21,23) |
| InChIK | XNSOUOVZJIYGGP-UHFFFAOYSA-N |
| TotalMolweight | 310.356 |
| Molweight | 310.356 |
| MonoisotopicMass | 310.142976 |
| CLogP | 1.7369 |
| CLogS | -2.928 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 256.24 |
| Relative PSA | 0.27896 |
| PolarSurfaceArea | 83.45 |
| Druglikeness | 4.2612 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-oxo-2-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]ethyl]-3-phenylpropanamide | 2 - N-[2-oxo-2-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]ethyl]-3-phenylpropanamide