| MolName | 6-[[(E)-3-phenylprop-2-enylidene]amino]-3H-1,3-benzothiazole-2-thione |
| MolecularFormula | C16H12N2S2 |
| Smiles | S=C1Sc(cc(cc2)/N=C/C=C/c3ccccc3)c2N1 |
| InChI | InChI=1S/C16H12N2S2/c19-16-18-14-9-8-13(11-15(14)20-16)17-10-4-7-12-5-2-1-3-6-12/h1-11H,(H,18,19) |
| InChIK | XOEUAOQEJMXSFW-UHFFFAOYSA-N |
| TotalMolweight | 296.417 |
| Molweight | 296.417 |
| MonoisotopicMass | 296.044188 |
| CLogP | 1.7115 |
| CLogS | -5.202 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 232.44 |
| Relative PSA | 0.29453 |
| PolarSurfaceArea | 81.78 |
| Druglikeness | 0.10546 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 6-[[(E)-3-phenylprop-2-enylidene]amino]-3H-1,3-benzothiazole-2-thione | 2 - 6-[[(E)-3-phenylprop-2-enylidene]amino]-3H-1,3-benzothiazole-2-thione