| MolName | 4,6-di(piperidin-1-yl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C21H26N7F3 |
| Smiles | FC(c1ccc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1)(F)F |
| InChI | InChI=1S/C21H26F3N7/c22-21(23,24)17-9-7-16(8-10-17)15-25-29-18-26-19(30-11-3-1-4-12-30)28-20(27-18)31-13-5-2-6-14-31/h7-10,15H,1-6,11-14H2,(H,26,27,28,29) |
| InChIK | XOHAJDMDHIBEGQ-UHFFFAOYSA-N |
| TotalMolweight | 433.48 |
| Molweight | 433.48 |
| MonoisotopicMass | 433.220177 |
| CLogP | 6.7768 |
| CLogS | -6.097 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 326.18 |
| Relative PSA | 0.19308 |
| PolarSurfaceArea | 69.54 |
| Druglikeness | -4.318 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 14 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-di(piperidin-1-yl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-di(piperidin-1-yl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazin-2-amine