| MolName | [2-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C25H17N3O8Br2 |
| Smiles | O=C(CNC(c(cc1)cc2c1OCO2)=O)N/N=C\c1cc(Br)cc(Br)c1OC(c(cc1)cc2c1OCO2)=O |
| InChI | InChI=1S/C25H17Br2N3O8/c26-16-5-15(23(17(27)8-16)38-25(33)14-2-4-19-21(7-14)37-12-35-19)9-29-30-22(31)10-28-24(32)13-1-3-18-20(6-13)36-11-34-18/h1-9H,10-12H2,(H,28,32)(H,30,31) |
| InChIK | XPADGXKECXZSOF-UHFFFAOYSA-N |
| TotalMolweight | 647.231 |
| Molweight | 647.231 |
| MonoisotopicMass | 644.938239 |
| CLogP | 5.389 |
| CLogS | -8.048 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 395.25 |
| Relative PSA | 0.31259 |
| PolarSurfaceArea | 133.78 |
| Druglikeness | 3.2348 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 1,3-benzodioxole-5-carboxylate | 2 - [2-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 1,3-benzodioxole-5-carboxylate