| MolName | 3-amino-4-(furan-2-yl)-6-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]furo[2,3-b]pyridine-2-carboxamide |
| MolecularFormula | C24H17N5O3 |
| Smiles | Nc1c(C(N/N=C\c2cnccc2)=O)oc2c1c(-c1ccco1)cc(-c1ccccc1)n2 |
| InChI | InChI=1S/C24H17N5O3/c25-21-20-17(19-9-5-11-31-19)12-18(16-7-2-1-3-8-16)28-24(20)32-22(21)23(30)29-27-14-15-6-4-10-26-13-15/h1-14H,25H2,(H,29,30) |
| InChIK | XPSUEJCKLSFOGT-UHFFFAOYSA-N |
| TotalMolweight | 423.431 |
| Molweight | 423.431 |
| MonoisotopicMass | 423.13314 |
| CLogP | 3.9461 |
| CLogS | -7.449 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 326.53 |
| Relative PSA | 0.31066 |
| PolarSurfaceArea | 119.54 |
| Druglikeness | 4.3604 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-amino-4-(furan-2-yl)-6-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]furo[2,3-b]pyridine-2-carboxamide | 2 - 3-amino-4-(furan-2-yl)-6-phenyl-N-[(Z)-pyridin-3-ylmethylideneamino]furo[2,3-b]pyridine-2-carboxamide