| MolName | 4-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C13H8N4OBr2S |
| Smiles | S=C(NN=C1c2ccccc2)N1/N=C\c(o1)cc(Br)c1Br |
| InChI | InChI=1S/C13H8Br2N4OS/c14-10-6-9(20-11(10)15)7-16-19-12(17-18-13(19)21)8-4-2-1-3-5-8/h1-7H,(H,18,21) |
| InChIK | XPZUZORNWFMEJD-UHFFFAOYSA-N |
| TotalMolweight | 428.108 |
| Molweight | 428.108 |
| MonoisotopicMass | 425.878553 |
| CLogP | 4.0315 |
| CLogS | -5.564 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 248.67 |
| Relative PSA | 0.32227 |
| PolarSurfaceArea | 85.22 |
| Druglikeness | -1.6669 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | 1,2-dihalo-alkene; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione