| MolName | 2-nitro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-4-(trifluoromethyl)aniline |
| MolecularFormula | C16H11N4O4F3 |
| Smiles | [O-][N+](c1c(/C=C/C=N\Nc(ccc(C(F)(F)F)c2)c2[N+]([O-])=O)cccc1)=O |
| InChI | InChI=1S/C16H11F3N4O4/c17-16(18,19)12-7-8-13(15(10-12)23(26)27)21-20-9-3-5-11-4-1-2-6-14(11)22(24)25/h1-10,21H |
| InChIK | XQEQGRAXVRIFJL-UHFFFAOYSA-N |
| TotalMolweight | 380.281 |
| Molweight | 380.281 |
| MonoisotopicMass | 380.07324 |
| CLogP | 3.8643 |
| CLogS | -5.139 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 272.54 |
| Relative PSA | 0.30751 |
| PolarSurfaceArea | 116.03 |
| Druglikeness | -10.275 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-nitro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-4-(trifluoromethyl)aniline | 2 - 2-nitro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-4-(trifluoromethyl)aniline