| MolName | [4-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate |
| MolecularFormula | C23H17N3O4FI |
| Smiles | O=C(CNC(c(cccc1)c1I)=O)N/N=C\c(cc1)ccc1OC(c(cccc1)c1F)=O |
| InChI | InChI=1S/C23H17FIN3O4/c24-19-7-3-1-5-17(19)23(31)32-16-11-9-15(10-12-16)13-27-28-21(29)14-26-22(30)18-6-2-4-8-20(18)25/h1-13H,14H2,(H,26,30)(H,28,29) |
| InChIK | XQQKRLWERVIGOS-UHFFFAOYSA-N |
| TotalMolweight | 545.303 |
| Molweight | 545.303 |
| MonoisotopicMass | 545.024783 |
| CLogP | 4.2537 |
| CLogS | -6.288 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 350.1 |
| Relative PSA | 0.23865 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 4.1323 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate | 2 - [4-[(Z)-[[2-[(2-iodobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate