| MolName | (Z)-N-[6-(2,4-dichlorophenyl)-3-(4-phenylphenyl)imidazo[1,2-a]imidazol-1-yl]-1-phenylmethanimine |
| MolecularFormula | C30H20N4Cl2 |
| Smiles | Clc(cc1)cc(Cl)c1-c1cn(c(-c(cc2)ccc2-c2ccccc2)cn2/N=C\c3ccccc3)c2n1 |
| InChI | InChI=1S/C30H20Cl2N4/c31-25-15-16-26(27(32)17-25)28-19-35-29(24-13-11-23(12-14-24)22-9-5-2-6-10-22)20-36(30(35)34-28)33-18-21-7-3-1-4-8-21/h1-20H |
| InChIK | XQVSBEQTCHAIJK-UHFFFAOYSA-N |
| TotalMolweight | 507.423 |
| Molweight | 507.423 |
| MonoisotopicMass | 506.1065 |
| CLogP | 7.7543 |
| CLogS | -10.882 |
| H Acceptors | 4 |
| TotalSurfaceArea | 381.11 |
| Relative PSA | 0.097872 |
| PolarSurfaceArea | 34.59 |
| Druglikeness | 4.7415 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47222 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 32 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[6-(2,4-dichlorophenyl)-3-(4-phenylphenyl)imidazo[1,2-a]imidazol-1-yl]-1-phenylmethanimine | 2 - (Z)-N-[6-(2,4-dichlorophenyl)-3-(4-phenylphenyl)imidazo[1,2-a]imidazol-1-yl]-1-phenylmethanimine