| MolName | 2-[(Z)-(3-iodophenyl)methylideneamino]guanidine |
| MolecularFormula | C8H9N4I |
| Smiles | NC(N)=N/N=C\c1cccc(I)c1 |
| InChI | InChI=1S/C8H9IN4/c9-7-3-1-2-6(4-7)5-12-13-8(10)11/h1-5H,(H4,10,11,13) |
| InChIK | XQZCXDWZAHCPLS-UHFFFAOYSA-N |
| TotalMolweight | 288.087 |
| Molweight | 288.087 |
| MonoisotopicMass | 287.987194 |
| CLogP | 2.3104 |
| CLogS | -4.006 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 164.31 |
| Relative PSA | 0.32597 |
| PolarSurfaceArea | 76.76 |
| Druglikeness | 2.1904 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 2 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Symmetricatoms | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(3-iodophenyl)methylideneamino]guanidine | 2 - 2-[(Z)-(3-iodophenyl)methylideneamino]guanidine