| MolName | 2-[(Z)-(1H-indole-7-carbonylhydrazinylidene)methyl]-4-nitrophenolate |
| MolecularFormula | C16H11N4O4 |
| Smiles | [O-]c(cc1)c(/C=N\NC(c2c3[nH]ccc3ccc2)=O)cc1[N+]([O-])=O |
| InChI | InChI=1S/C16H12N4O4/c21-14-5-4-12(20(23)24)8-11(14)9-18-19-16(22)13-3-1-2-10-6-7-17-15(10)13/h1-9,17,21H,(H,19,22)/p-1 |
| InChIK | XRLYSOSWDPXXAX-UHFFFAOYSA-M |
| TotalMolweight | 323.287 |
| Molweight | 323.287 |
| MonoisotopicMass | 323.078031 |
| CLogP | 0.3957 |
| CLogS | -4.41 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 242.36 |
| Relative PSA | 0.39074 |
| PolarSurfaceArea | 126.13 |
| Druglikeness | -0.59223 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(1H-indole-7-carbonylhydrazinylidene)methyl]-4-nitrophenolate | 2 - 2-[(Z)-(1H-indole-7-carbonylhydrazinylidene)methyl]-4-nitrophenolate