| MolName | [4-bromo-2-[(Z)-[[2-[(3-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C21H15N3O5BrF |
| Smiles | O=C(CNC(c1cc(F)ccc1)=O)N/N=C\c(cc(cc1)Br)c1OC(c1ccco1)=O |
| InChI | InChI=1S/C21H15BrFN3O5/c22-15-6-7-17(31-21(29)18-5-2-8-30-18)14(9-15)11-25-26-19(27)12-24-20(28)13-3-1-4-16(23)10-13/h1-11H,12H2,(H,24,28)(H,26,27) |
| InChIK | XRMNNDBRLJTPMK-UHFFFAOYSA-N |
| TotalMolweight | 488.268 |
| Molweight | 488.268 |
| MonoisotopicMass | 487.017911 |
| CLogP | 3.7305 |
| CLogS | -5.788 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 332.14 |
| Relative PSA | 0.29403 |
| PolarSurfaceArea | 110 |
| Druglikeness | 2.1854 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-[(3-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [4-bromo-2-[(Z)-[[2-[(3-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate