| MolName | [4-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| MolecularFormula | C26H19N2O4Br |
| Smiles | O=C(COc1cccc2ccccc12)N/N=C\c(cc1)ccc1OC(c(cccc1)c1Br)=O |
| InChI | InChI=1S/C26H19BrN2O4/c27-23-10-4-3-9-22(23)26(31)33-20-14-12-18(13-15-20)16-28-29-25(30)17-32-24-11-5-7-19-6-1-2-8-21(19)24/h1-16H,17H2,(H,29,30) |
| InChIK | XRNKUCABWCEZPP-UHFFFAOYSA-N |
| TotalMolweight | 503.351 |
| Molweight | 503.351 |
| MonoisotopicMass | 502.052819 |
| CLogP | 6.1266 |
| CLogS | -7.411 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 351.49 |
| Relative PSA | 0.19645 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 2.1789 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-bromobenzoate | 2 - [4-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-bromobenzoate