| MolName | N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-2-(2-fluorophenoxy)acetamide |
| MolecularFormula | C16H13N2O3F3 |
| Smiles | O=C(COc(cccc1)c1F)N/N=C\c(cc1)ccc1OC(F)F |
| InChI | InChI=1S/C16H13F3N2O3/c17-13-3-1-2-4-14(13)23-10-15(22)21-20-9-11-5-7-12(8-6-11)24-16(18)19/h1-9,16H,10H2,(H,21,22) |
| InChIK | XROLYPMALBAALH-UHFFFAOYSA-N |
| TotalMolweight | 338.284 |
| Molweight | 338.284 |
| MonoisotopicMass | 338.087827 |
| CLogP | 3.0467 |
| CLogS | -4.437 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 252.3 |
| Relative PSA | 0.222 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 1.4091 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-2-(2-fluorophenoxy)acetamide | 2 - N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-2-(2-fluorophenoxy)acetamide