| MolName | 2-nitro-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide |
| MolecularFormula | C14H10N4O5 |
| Smiles | [O-][N+](c1cccc(/C=N\NC(c(cccc2)c2[N+]([O-])=O)=O)c1)=O |
| InChI | InChI=1S/C14H10N4O5/c19-14(12-6-1-2-7-13(12)18(22)23)16-15-9-10-4-3-5-11(8-10)17(20)21/h1-9H,(H,16,19) |
| InChIK | XRQIXWWMXAVIER-UHFFFAOYSA-N |
| TotalMolweight | 314.256 |
| Molweight | 314.256 |
| MonoisotopicMass | 314.065121 |
| CLogP | 1.3584 |
| CLogS | -4.641 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 234.33 |
| Relative PSA | 0.41331 |
| PolarSurfaceArea | 133.1 |
| Druglikeness | -0.75305 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-nitro-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide | 2 - 2-nitro-N-[(Z)-(3-nitrophenyl)methylideneamino]benzamide