| MolName | 4-[(Z)-[[2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C24H17N5O3Cl2S |
| Smiles | OC(c1ccc(/C=N\NC(CSc2nnc(-c(cc3)ccc3Cl)n2-c(cc2)ccc2Cl)=O)cc1)=O |
| InChI | InChI=1S/C24H17Cl2N5O3S/c25-18-7-5-16(6-8-18)22-29-30-24(31(22)20-11-9-19(26)10-12-20)35-14-21(32)28-27-13-15-1-3-17(4-2-15)23(33)34/h1-13H,14H2,(H,28,32)(H,33,34) |
| InChIK | XRSNTJCGDYITFZ-UHFFFAOYSA-N |
| TotalMolweight | 526.403 |
| Molweight | 526.403 |
| MonoisotopicMass | 525.042914 |
| CLogP | 5.2289 |
| CLogS | -9.901 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 379.42 |
| Relative PSA | 0.28583 |
| PolarSurfaceArea | 134.77 |
| Druglikeness | 5.274 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid | 2 - 4-[(Z)-[[2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid