| MolName | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]acetamide |
| MolecularFormula | C27H21N3O2S2 |
| Smiles | O=C(CSc1nc(cccc2)c2s1)N/N=C/c(c1ccccc1cc1)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H21N3O2S2/c31-26(18-33-27-29-23-12-6-7-13-25(23)34-27)30-28-16-22-21-11-5-4-10-20(21)14-15-24(22)32-17-19-8-2-1-3-9-19/h1-16H,17-18H2,(H,30,31) |
| InChIK | XRWMIMBJWCJEMO-UHFFFAOYSA-N |
| TotalMolweight | 483.615 |
| Molweight | 483.615 |
| MonoisotopicMass | 483.107517 |
| CLogP | 6.4588 |
| CLogS | -8.046 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 365.66 |
| Relative PSA | 0.25934 |
| PolarSurfaceArea | 117.12 |
| Druglikeness | 4.4451 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]acetamide | 2 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]acetamide