| MolName | 2-(3-chlorophenoxy)-N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide |
| MolecularFormula | C17H14N3O4Cl |
| Smiles | [O-][N+](c1cccc(/C=C/C=N\NC(COc2cccc(Cl)c2)=O)c1)=O |
| InChI | InChI=1S/C17H14ClN3O4/c18-14-6-2-8-16(11-14)25-12-17(22)20-19-9-3-5-13-4-1-7-15(10-13)21(23)24/h1-11H,12H2,(H,20,22) |
| InChIK | XRXUMKXTHRIBRA-UHFFFAOYSA-N |
| TotalMolweight | 359.768 |
| Molweight | 359.768 |
| MonoisotopicMass | 359.067284 |
| CLogP | 2.4792 |
| CLogS | -4.989 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 276.34 |
| Relative PSA | 0.27658 |
| PolarSurfaceArea | 96.51 |
| Druglikeness | -0.78745 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(3-chlorophenoxy)-N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide | 2 - 2-(3-chlorophenoxy)-N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide