| MolName | 2-(4-chlorophenyl)-N-[(Z)-2-phenylethylideneamino]acetamide |
| MolecularFormula | C16H15N2OCl |
| Smiles | O=C(Cc(cc1)ccc1Cl)N/N=C\Cc1ccccc1 |
| InChI | InChI=1S/C16H15ClN2O/c17-15-8-6-14(7-9-15)12-16(20)19-18-11-10-13-4-2-1-3-5-13/h1-9,11H,10,12H2,(H,19,20) |
| InChIK | XSEKMGOIXZIWPX-UHFFFAOYSA-N |
| TotalMolweight | 286.761 |
| Molweight | 286.761 |
| MonoisotopicMass | 286.08729 |
| CLogP | 3.4929 |
| CLogS | -4.309 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 229.93 |
| Relative PSA | 0.15661 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 4.3905 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chlorophenyl)-N-[(Z)-2-phenylethylideneamino]acetamide | 2 - 2-(4-chlorophenyl)-N-[(Z)-2-phenylethylideneamino]acetamide