| MolName | 3-[2-[(4-chlorophenyl)methoxy]phenyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C24H18N5O4Cl |
| Smiles | [O-][N+](c1ccc(/C=N\NC(c2cc(-c(cccc3)c3OCc(cc3)ccc3Cl)n[nH]2)=O)cc1)=O |
| InChI | InChI=1S/C24H18ClN5O4/c25-18-9-5-17(6-10-18)15-34-23-4-2-1-3-20(23)21-13-22(28-27-21)24(31)29-26-14-16-7-11-19(12-8-16)30(32)33/h1-14H,15H2,(H,27,28)(H,29,31) |
| InChIK | XSNDHDQFSNJIKO-UHFFFAOYSA-N |
| TotalMolweight | 475.891 |
| Molweight | 475.891 |
| MonoisotopicMass | 475.104732 |
| CLogP | 3.9319 |
| CLogS | -6.633 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 357.69 |
| Relative PSA | 0.28346 |
| PolarSurfaceArea | 125.19 |
| Druglikeness | 0.30611 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[2-[(4-chlorophenyl)methoxy]phenyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide | 2 - 3-[2-[(4-chlorophenyl)methoxy]phenyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide