| MolName | (8R)-6-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| MolecularFormula | C21H16N5O4Cl |
| Smiles | [O-][N+](c(cc1)cc(/C=N\N(CC(N(C2)[C@@H]3Cc4c2[nH]c2c4cccc2)=O)C3=O)c1Cl)=O |
| InChI | InChI=1S/C21H16ClN5O4/c22-16-6-5-13(27(30)31)7-12(16)9-23-26-11-20(28)25-10-18-15(8-19(25)21(26)29)14-3-1-2-4-17(14)24-18/h1-7,9,19,24H,8,10-11H2/t19-/m1/s1 |
| InChIK | XSQJFSNARDFHRB-LJQANCHMSA-N |
| TotalMolweight | 437.842 |
| Molweight | 437.842 |
| MonoisotopicMass | 437.089082 |
| CLogP | 1.4989 |
| CLogS | -4.792 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 303.92 |
| Relative PSA | 0.29317 |
| PolarSurfaceArea | 114.59 |
| Druglikeness | 2.4703 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| StereoCenters | 1 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (8R)-6-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione | 2 - (8R)-6-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione