| MolName | N-[(Z)-[1-[2-(2,5-dichlorophenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C20H16N4OCl2S |
| Smiles | Clc(cc1)cc(OCCn2c(/C=N\Nc3nc(cccc4)c4s3)ccc2)c1Cl |
| InChI | InChI=1S/C20H16Cl2N4OS/c21-14-7-8-16(22)18(12-14)27-11-10-26-9-3-4-15(26)13-23-25-20-24-17-5-1-2-6-19(17)28-20/h1-9,12-13H,10-11H2,(H,24,25) |
| InChIK | XSTIGKACDKVNFP-UHFFFAOYSA-N |
| TotalMolweight | 431.346 |
| Molweight | 431.346 |
| MonoisotopicMass | 430.042185 |
| CLogP | 7.0393 |
| CLogS | -5.254 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 315.86 |
| Relative PSA | 0.22532 |
| PolarSurfaceArea | 79.68 |
| Druglikeness | 5.1164 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[2-(2,5-dichlorophenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-[1-[2-(2,5-dichlorophenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine