| MolName | N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]acetamide |
| MolecularFormula | C15H13N3O4BrCl |
| Smiles | O=C(CNC(COc(cc1)ccc1Cl)=O)N/N=C\c(o1)ccc1Br |
| InChI | InChI=1S/C15H13BrClN3O4/c16-13-6-5-12(24-13)7-19-20-14(21)8-18-15(22)9-23-11-3-1-10(17)2-4-11/h1-7H,8-9H2,(H,18,22)(H,20,21) |
| InChIK | XTAFFUKAKAWNIW-UHFFFAOYSA-N |
| TotalMolweight | 414.642 |
| Molweight | 414.642 |
| MonoisotopicMass | 412.977795 |
| CLogP | 2.4775 |
| CLogS | -4.283 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 277.46 |
| Relative PSA | 0.30498 |
| PolarSurfaceArea | 92.93 |
| Druglikeness | 4.0311 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]acetamide | 2 - N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]acetamide