| MolName | 1-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-(4-fluorophenyl)thiourea |
| MolecularFormula | C14H10N4O2ClFS |
| Smiles | [O-][N+](c(cc(/C=N\NC(Nc(cc1)ccc1F)=S)cc1)c1Cl)=O |
| InChI | InChI=1S/C14H10ClFN4O2S/c15-12-6-1-9(7-13(12)20(21)22)8-17-19-14(23)18-11-4-2-10(16)3-5-11/h1-8H,(H2,18,19,23) |
| InChIK | XTDGICKUDBZVCK-UHFFFAOYSA-N |
| TotalMolweight | 352.776 |
| Molweight | 352.776 |
| MonoisotopicMass | 352.019701 |
| CLogP | 3.3774 |
| CLogS | -5.831 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 258.85 |
| Relative PSA | 0.3587 |
| PolarSurfaceArea | 114.33 |
| Druglikeness | -4.3153 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-(4-fluorophenyl)thiourea | 2 - 1-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-(4-fluorophenyl)thiourea