| MolName | (Z)-1-[5-(2-chlorophenyl)furan-2-yl]-N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]methanimine |
| MolecularFormula | C22H14N2O2Cl2 |
| Smiles | Clc(cccc1)c1-c1ccc(/C=N\N=C/c2ccc(-c(cccc3)c3Cl)o2)o1 |
| InChI | InChI=1S/C22H14Cl2N2O2/c23-19-7-3-1-5-17(19)21-11-9-15(27-21)13-25-26-14-16-10-12-22(28-16)18-6-2-4-8-20(18)24/h1-14H |
| InChIK | XTDUFDRSRRMFMQ-UHFFFAOYSA-N |
| TotalMolweight | 409.271 |
| Molweight | 409.271 |
| MonoisotopicMass | 408.043232 |
| CLogP | 7.8754 |
| CLogS | -8.524 |
| H Acceptors | 4 |
| TotalSurfaceArea | 312.28 |
| Relative PSA | 0.16408 |
| PolarSurfaceArea | 51 |
| Druglikeness | 3.9071 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-(2-chlorophenyl)furan-2-yl]-N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]methanimine | 2 - (Z)-1-[5-(2-chlorophenyl)furan-2-yl]-N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]methanimine