| MolName | 2-bromo-4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-6-nitrophenolate |
| MolecularFormula | C21H15N3O5Br |
| Smiles | [O-]c(c([N+]([O-])=O)cc(/C=N\NC(C(c1ccccc1)(c1ccccc1)O)=O)c1)c1Br |
| InChI | InChI=1S/C21H16BrN3O5/c22-17-11-14(12-18(19(17)26)25(29)30)13-23-24-20(27)21(28,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,26,28H,(H,24,27)/p-1 |
| InChIK | XTOJQIYXVKNALN-UHFFFAOYSA-M |
| TotalMolweight | 469.27 |
| Molweight | 469.27 |
| MonoisotopicMass | 468.019508 |
| CLogP | 1.3618 |
| CLogS | -5.425 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 313.34 |
| Relative PSA | 0.29939 |
| PolarSurfaceArea | 130.57 |
| Druglikeness | -1.4805 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 8 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-bromo-4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-6-nitrophenolate | 2 - 2-bromo-4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-6-nitrophenolate