| MolName | [1-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
| MolecularFormula | C30H21N2O4Cl |
| Smiles | O=C(COc1cc2ccccc2cc1)N/N=C\c(c1ccccc1cc1)c1OC(c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C30H21ClN2O4/c31-27-12-6-5-11-25(27)30(35)37-28-16-14-21-8-3-4-10-24(21)26(28)18-32-33-29(34)19-36-23-15-13-20-7-1-2-9-22(20)17-23/h1-18H,19H2,(H,33,34) |
| InChIK | XTXPTKLUERPAFJ-UHFFFAOYSA-N |
| TotalMolweight | 508.96 |
| Molweight | 508.96 |
| MonoisotopicMass | 508.118985 |
| CLogP | 7.2018 |
| CLogS | -8.919 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 382.88 |
| Relative PSA | 0.18034 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 4.0206 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54054 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate | 2 - [1-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate