| MolName | 4-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C22H16N6S2 |
| Smiles | S=C(NN=C1c2cccs2)N1/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H16N6S2/c29-22-25-24-21(19-12-7-13-30-19)28(22)23-14-17-15-27(18-10-5-2-6-11-18)26-20(17)16-8-3-1-4-9-16/h1-15H,(H,25,29) |
| InChIK | XUABPJVSOFIUNS-UHFFFAOYSA-N |
| TotalMolweight | 428.543 |
| Molweight | 428.543 |
| MonoisotopicMass | 428.087784 |
| CLogP | 4.0806 |
| CLogS | -5.974 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 325.14 |
| Relative PSA | 0.32057 |
| PolarSurfaceArea | 118.14 |
| Druglikeness | 5.6652 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione