| MolName | 3,5-dichloro-N-[(Z)-furan-2-ylmethylideneamino]pyridin-2-amine |
| MolecularFormula | C10H7N3OCl2 |
| Smiles | Clc1cc(Cl)c(N/N=C\c2ccco2)nc1 |
| InChI | InChI=1S/C10H7Cl2N3O/c11-7-4-9(12)10(13-5-7)15-14-6-8-2-1-3-16-8/h1-6H,(H,13,15) |
| InChIK | XURKYDOASRLXEE-UHFFFAOYSA-N |
| TotalMolweight | 256.092 |
| Molweight | 256.092 |
| MonoisotopicMass | 254.996616 |
| CLogP | 4.5921 |
| CLogS | -4.033 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 188.53 |
| Relative PSA | 0.25487 |
| PolarSurfaceArea | 50.42 |
| Druglikeness | 1.9025 |
| Mutagenic | none |
| Tumorigenic | low |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3,5-dichloro-N-[(Z)-furan-2-ylmethylideneamino]pyridin-2-amine | 2 - 3,5-dichloro-N-[(Z)-furan-2-ylmethylideneamino]pyridin-2-amine