| MolName | 1-cyclohexyl-3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]thiourea |
| MolecularFormula | C16H20N4O2S |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(NC2CCCCC2)=S)cccc1)=O |
| InChI | InChI=1S/C16H20N4O2S/c21-20(22)15-11-5-4-7-13(15)8-6-12-17-19-16(23)18-14-9-2-1-3-10-14/h4-8,11-12,14H,1-3,9-10H2,(H2,18,19,23) |
| InChIK | XUWSCSPPJSZYHE-UHFFFAOYSA-N |
| TotalMolweight | 332.427 |
| Molweight | 332.427 |
| MonoisotopicMass | 332.130696 |
| CLogP | 2.5359 |
| CLogS | -5.14 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 271.62 |
| Relative PSA | 0.34184 |
| PolarSurfaceArea | 114.33 |
| Druglikeness | -7.5775 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-cyclohexyl-3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]thiourea | 2 - 1-cyclohexyl-3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]thiourea