| MolName | 2-thiophen-2-yl-N-[(E)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C11H10N2OS2 |
| Smiles | O=C(Cc1cccs1)N/N=C/c1cccs1 |
| InChI | InChI=1S/C11H10N2OS2/c14-11(7-9-3-1-5-15-9)13-12-8-10-4-2-6-16-10/h1-6,8H,7H2,(H,13,14) |
| InChIK | XUYPQDVJFSJFJI-UHFFFAOYSA-N |
| TotalMolweight | 250.345 |
| Molweight | 250.345 |
| MonoisotopicMass | 250.023453 |
| CLogP | 2.9329 |
| CLogS | -3.706 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 192.63 |
| Relative PSA | 0.39833 |
| PolarSurfaceArea | 97.94 |
| Druglikeness | 6.1501 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-thiophen-2-yl-N-[(E)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-thiophen-2-yl-N-[(E)-thiophen-2-ylmethylideneamino]acetamide