| MolName | N-[(Z)-3-[(2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C24H17N4O6Br |
| Smiles | [O-][N+](c1ccc(/C=C(/C(N/N=C\c(cc2OCOc2c2)c2Br)=O)\NC(c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C24H17BrN4O6/c25-19-12-22-21(34-14-35-22)11-17(19)13-26-28-24(31)20(27-23(30)16-4-2-1-3-5-16)10-15-6-8-18(9-7-15)29(32)33/h1-13H,14H2,(H,27,30)(H,28,31) |
| InChIK | XVBJAZWECVSEOD-UHFFFAOYSA-N |
| TotalMolweight | 537.325 |
| Molweight | 537.325 |
| MonoisotopicMass | 536.033147 |
| CLogP | 4.7333 |
| CLogS | -7.471 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 363.23 |
| Relative PSA | 0.3054 |
| PolarSurfaceArea | 134.84 |
| Druglikeness | -0.58586 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-3-[(2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(Z)-3-[(2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide