| MolName | (Z)-1-[3-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C23H26N4O2 |
| Smiles | C(COc1cc(/C=N\n2cnnc2)ccc1)Oc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-2-6-20(7-3-1)21-9-11-22(12-10-21)28-13-14-29-23-8-4-5-19(15-23)16-26-27-17-24-25-18-27/h4-5,8-12,15-18,20H,1-3,6-7,13-14H2 |
| InChIK | XWGLXHWGQPJYSQ-UHFFFAOYSA-N |
| TotalMolweight | 390.485 |
| Molweight | 390.485 |
| MonoisotopicMass | 390.205576 |
| CLogP | 4.7201 |
| CLogS | -7.345 |
| H Acceptors | 6 |
| TotalSurfaceArea | 319.58 |
| Relative PSA | 0.18875 |
| PolarSurfaceArea | 61.53 |
| Druglikeness | -8.6548 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 10 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[3-[2-(4-cyclohexylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine