| MolName | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-2-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C26H19N7O4F6 |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(OC(C(F)(F)F)C(F)(F)F)nc(N/N=C\c(cc2)ccc2OCc2ccccc2)n1)=O |
| InChI | InChI=1S/C26H19F6N7O4/c27-25(28,29)21(26(30,31)32)43-24-36-22(34-18-8-10-19(11-9-18)39(40)41)35-23(37-24)38-33-14-16-6-12-20(13-7-16)42-15-17-4-2-1-3-5-17/h1-14,21H,15H2,(H2,34,35,36,37,38) |
| InChIK | XWPHYVWAEJBKBW-UHFFFAOYSA-N |
| TotalMolweight | 607.47 |
| Molweight | 607.47 |
| MonoisotopicMass | 607.140271 |
| CLogP | 7.8836 |
| CLogS | -8.89 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 425.35 |
| Relative PSA | 0.27685 |
| PolarSurfaceArea | 139.37 |
| Druglikeness | -15.089 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.53488 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 17 |
| Electronegative Atoms | 17 |
| Rotatable Bond | 13 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 7 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-2-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine | 2 - 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-2-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine