| MolName | 2-[[4-[(Z)-(4-bromophenyl)methylideneamino]-5-cyclopropyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dicyclohexylacetamide |
| MolecularFormula | C26H34N5OBrS |
| Smiles | O=C(CSc1nnc(C2CC2)n1/N=C\c(cc1)ccc1Br)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H34BrN5OS/c27-21-15-11-19(12-16-21)17-28-32-25(20-13-14-20)29-30-26(32)34-18-24(33)31(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h11-12,15-17,20,22-23H,1-10,13-14,18H2 |
| InChIK | XWWSRPWTYIZXTC-UHFFFAOYSA-N |
| TotalMolweight | 544.56 |
| Molweight | 544.56 |
| MonoisotopicMass | 543.166741 |
| CLogP | 6.2254 |
| CLogS | -8.487 |
| H Acceptors | 6 |
| TotalSurfaceArea | 384.55 |
| Relative PSA | 0.19347 |
| PolarSurfaceArea | 88.68 |
| Druglikeness | -6.0167 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 17 |
| Symmetricatoms | 11 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-[(Z)-(4-bromophenyl)methylideneamino]-5-cyclopropyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dicyclohexylacetamide | 2 - 2-[[4-[(Z)-(4-bromophenyl)methylideneamino]-5-cyclopropyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dicyclohexylacetamide