| MolName | N-[(Z)-benzylideneamino]-2-[4-[2-[(2Z)-2-benzylidenehydrazinyl]-2-oxoethoxy]phenoxy]acetamide |
| MolecularFormula | C24H22N4O4 |
| Smiles | O=C(COc(cc1)ccc1OCC(N/N=C\c1ccccc1)=O)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C24H22N4O4/c29-23(27-25-15-19-7-3-1-4-8-19)17-31-21-11-13-22(14-12-21)32-18-24(30)28-26-16-20-9-5-2-6-10-20/h1-16H,17-18H2,(H,27,29)(H,28,30) |
| InChIK | XXEPKRNTAPDLJF-UHFFFAOYSA-N |
| TotalMolweight | 430.463 |
| Molweight | 430.463 |
| MonoisotopicMass | 430.164106 |
| CLogP | 3.8934 |
| CLogS | -5.386 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 348.24 |
| Relative PSA | 0.26424 |
| PolarSurfaceArea | 101.38 |
| Druglikeness | 4.1966 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 19 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-2-[4-[2-[(2Z)-2-benzylidenehydrazinyl]-2-oxoethoxy]phenoxy]acetamide | 2 - N-[(Z)-benzylideneamino]-2-[4-[2-[(2Z)-2-benzylidenehydrazinyl]-2-oxoethoxy]phenoxy]acetamide