| MolName | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
| MolecularFormula | C23H16N4O3Cl4 |
| Smiles | O=C(COc(cccc1)c1C(N/N=C\c(c(Cl)ccc1)c1Cl)=O)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C23H16Cl4N4O3/c24-17-6-3-7-18(25)15(17)11-28-30-22(32)13-34-21-10-2-1-5-14(21)23(33)31-29-12-16-19(26)8-4-9-20(16)27/h1-12H,13H2,(H,30,32)(H,31,33) |
| InChIK | XYEYOVWLWDQXFW-UHFFFAOYSA-N |
| TotalMolweight | 538.217 |
| Molweight | 538.217 |
| MonoisotopicMass | 535.997649 |
| CLogP | 6.7425 |
| CLogS | -8.55 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 386.16 |
| Relative PSA | 0.2124 |
| PolarSurfaceArea | 92.15 |
| Druglikeness | 4.2278 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide | 2 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide