| MolName | 3-(1,2-dihydroacenaphthylen-5-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C25H20N4O |
| Smiles | O=C(c1cc(-c2ccc(CC3)c4c3cccc24)n[nH]1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C25H20N4O/c30-25(29-26-15-5-8-17-6-2-1-3-7-17)23-16-22(27-28-23)20-14-13-19-12-11-18-9-4-10-21(20)24(18)19/h1-10,13-16H,11-12H2,(H,27,28)(H,29,30) |
| InChIK | XYKMLQFAUOEPQC-UHFFFAOYSA-N |
| TotalMolweight | 392.461 |
| Molweight | 392.461 |
| MonoisotopicMass | 392.163711 |
| CLogP | 4.5849 |
| CLogS | -6.546 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 310.2 |
| Relative PSA | 0.19655 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | 4.4834 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(1,2-dihydroacenaphthylen-5-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide | 2 - 3-(1,2-dihydroacenaphthylen-5-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide