| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
| MolecularFormula | C20H17N9O4 |
| Smiles | NC(COc1ccc(/C=N\NC(c2c(-c3ccccc3)n(-c3nonc3N)nn2)=O)cc1)=O |
| InChI | InChI=1S/C20H17N9O4/c21-15(30)11-32-14-8-6-12(7-9-14)10-23-25-20(31)16-17(13-4-2-1-3-5-13)29(28-24-16)19-18(22)26-33-27-19/h1-10H,11H2,(H2,21,30)(H2,22,26)(H,25,31) |
| InChIK | XYLPYCZPIXTMCO-UHFFFAOYSA-N |
| TotalMolweight | 447.414 |
| Molweight | 447.414 |
| MonoisotopicMass | 447.140351 |
| CLogP | 2.1078 |
| CLogS | -3.075 |
| H Acceptors | 13 |
| H Donors | 3 |
| TotalSurfaceArea | 338.99 |
| Relative PSA | 0.45562 |
| PolarSurfaceArea | 189.43 |
| Druglikeness | 2.23 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide