| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1-phenyltetrazol-5-amine |
| MolecularFormula | C14H10N6Cl2 |
| Smiles | Clc1cc(Cl)c(/C=N\Nc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H10Cl2N6/c15-11-7-6-10(13(16)8-11)9-17-18-14-19-20-21-22(14)12-4-2-1-3-5-12/h1-9H,(H,18,19,21) |
| InChIK | XZCMUWXCMOZMLZ-UHFFFAOYSA-N |
| TotalMolweight | 333.181 |
| Molweight | 333.181 |
| MonoisotopicMass | 332.034398 |
| CLogP | 5.321 |
| CLogS | -5.191 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 245.32 |
| Relative PSA | 0.25579 |
| PolarSurfaceArea | 67.99 |
| Druglikeness | 2.2373 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1-phenyltetrazol-5-amine | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1-phenyltetrazol-5-amine