| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[2-[2-(4-bromophenoxy)ethoxy]-5-nitrophenyl]methylideneamino]acetamide |
| MolecularFormula | C19H17N6O5BrS |
| Smiles | Nc1nnc(CC(N/N=C\c(cc(cc2)[N+]([O-])=O)c2OCCOc(cc2)ccc2Br)=O)s1 |
| InChI | InChI=1S/C19H17BrN6O5S/c20-13-1-4-15(5-2-13)30-7-8-31-16-6-3-14(26(28)29)9-12(16)11-22-23-17(27)10-18-24-25-19(21)32-18/h1-6,9,11H,7-8,10H2,(H2,21,25)(H,23,27) |
| InChIK | XZDHQKFWUWITAJ-UHFFFAOYSA-N |
| TotalMolweight | 521.351 |
| Molweight | 521.351 |
| MonoisotopicMass | 520.01645 |
| CLogP | 2.524 |
| CLogS | -5.531 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 352.31 |
| Relative PSA | 0.40873 |
| PolarSurfaceArea | 185.78 |
| Druglikeness | -8.2185 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[2-[2-(4-bromophenoxy)ethoxy]-5-nitrophenyl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[2-[2-(4-bromophenoxy)ethoxy]-5-nitrophenyl]methylideneamino]acetamide