| MolName | (Z)-1-[5-(2-bromo-4-nitrophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C13H8N5O3Br |
| Smiles | [O-][N+](c(cc1)cc(Br)c1-c1ccc(/C=N\n2cnnc2)o1)=O |
| InChI | InChI=1S/C13H8BrN5O3/c14-12-5-9(19(20)21)1-3-11(12)13-4-2-10(22-13)6-17-18-7-15-16-8-18/h1-8H |
| InChIK | XZDNFGFNLDWJAV-UHFFFAOYSA-N |
| TotalMolweight | 362.143 |
| Molweight | 362.143 |
| MonoisotopicMass | 360.981051 |
| CLogP | 1.9708 |
| CLogS | -7.064 |
| H Acceptors | 8 |
| TotalSurfaceArea | 236.25 |
| Relative PSA | 0.35915 |
| PolarSurfaceArea | 102.03 |
| Druglikeness | -0.88631 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-(2-bromo-4-nitrophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[5-(2-bromo-4-nitrophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine