| MolName | 6-chloro-2-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]pyrimidine-2,4-diamine |
| MolecularFormula | C11H5N5ClF5 |
| Smiles | Nc1cc(Cl)nc(N/N=C\c(c(F)c(c(F)c2F)F)c2F)n1 |
| InChI | InChI=1S/C11H5ClF5N5/c12-4-1-5(18)21-11(20-4)22-19-2-3-6(13)8(15)10(17)9(16)7(3)14/h1-2H,(H3,18,20,21,22) |
| InChIK | XZFNGVOGYMDJDW-UHFFFAOYSA-N |
| TotalMolweight | 337.639 |
| Molweight | 337.639 |
| MonoisotopicMass | 337.015362 |
| CLogP | 4.5287 |
| CLogS | -5.086 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 222.45 |
| Relative PSA | 0.27053 |
| PolarSurfaceArea | 76.19 |
| Druglikeness | 0.91392 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 6-chloro-2-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]pyrimidine-2,4-diamine | 2 - 6-chloro-2-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]pyrimidine-2,4-diamine