| MolName | [2-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-4,6-dibromophenyl] 3-fluorobenzoate |
| MolecularFormula | C22H13N2O5Br2F |
| Smiles | O=C(c(cc1)cc2c1OCO2)N/N=C\c1cc(Br)cc(Br)c1OC(c1cc(F)ccc1)=O |
| InChI | InChI=1S/C22H13Br2FN2O5/c23-15-6-14(10-26-27-21(28)12-4-5-18-19(8-12)31-11-30-18)20(17(24)9-15)32-22(29)13-2-1-3-16(25)7-13/h1-10H,11H2,(H,27,28) |
| InChIK | XZPHCPOTGWXJFQ-UHFFFAOYSA-N |
| TotalMolweight | 564.16 |
| Molweight | 564.16 |
| MonoisotopicMass | 561.917523 |
| CLogP | 6.2947 |
| CLogS | -7.884 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 338.37 |
| Relative PSA | 0.23362 |
| PolarSurfaceArea | 86.22 |
| Druglikeness | 0.82396 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-4,6-dibromophenyl] 3-fluorobenzoate | 2 - [2-[(Z)-(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-4,6-dibromophenyl] 3-fluorobenzoate