| MolName | 4-[(Z)-[4-(5-bromothiophen-2-yl)-2-cyclohexylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| MolecularFormula | C21H19N4BrS2 |
| Smiles | N#Cc1ccc(/C=N\N(C(c(s2)ccc2Br)=CS2)/C2=N/C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H19BrN4S2/c22-20-11-10-19(28-20)18-14-27-21(25-17-4-2-1-3-5-17)26(18)24-13-16-8-6-15(12-23)7-9-16/h6-11,13-14,17H,1-5H2 |
| InChIK | XZXDSVFOMHNLBX-UHFFFAOYSA-N |
| TotalMolweight | 471.446 |
| Molweight | 471.446 |
| MonoisotopicMass | 470.023447 |
| CLogP | 6.2378 |
| CLogS | -7.68 |
| H Acceptors | 4 |
| TotalSurfaceArea | 323.83 |
| Relative PSA | 0.24081 |
| PolarSurfaceArea | 105.29 |
| Druglikeness | -9.2042 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[4-(5-bromothiophen-2-yl)-2-cyclohexylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile | 2 - 4-[(Z)-[4-(5-bromothiophen-2-yl)-2-cyclohexylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile