| MolName | (Z)-phenanthren-9-ylmethylidenehydrazine |
| MolecularFormula | C15H12N2 |
| Smiles | N/N=C\c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C15H12N2/c16-17-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-10H,16H2 |
| InChIK | XZZCPHNDVSXXST-UHFFFAOYSA-N |
| TotalMolweight | 220.274 |
| Molweight | 220.274 |
| MonoisotopicMass | 220.100048 |
| CLogP | 3.9556 |
| CLogS | -5.605 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 175.74 |
| Relative PSA | 0.15238 |
| PolarSurfaceArea | 38.38 |
| Druglikeness | -2.3346 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 2 |
| Electronegative Atoms | 2 |
| Rotatable Bond | 1 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-phenanthren-9-ylmethylidenehydrazine | 2 - (Z)-phenanthren-9-ylmethylidenehydrazine