| MolName | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylacetamide |
| MolecularFormula | C22H18N2O2Cl2 |
| Smiles | O=C(Cc1ccccc1)N/N=C\c(cc1)ccc1OCc(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C22H18Cl2N2O2/c23-19-9-8-18(21(24)13-19)15-28-20-10-6-17(7-11-20)14-25-26-22(27)12-16-4-2-1-3-5-16/h1-11,13-14H,12,15H2,(H,26,27) |
| InChIK | YAGHPLMGERESJE-UHFFFAOYSA-N |
| TotalMolweight | 413.303 |
| Molweight | 413.303 |
| MonoisotopicMass | 412.074532 |
| CLogP | 5.7598 |
| CLogS | -6.499 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 315.11 |
| Relative PSA | 0.14601 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 4.0496 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylacetamide | 2 - N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylacetamide