| MolName | 2-iodo-6-nitro-4-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]phenolate |
| MolecularFormula | C17H12N4O4IS |
| Smiles | [O-]c(c([N+]([O-])=O)cc(/C=N\N(C=Nc1c2c(CCCC3)c3s1)C2=O)c1)c1I |
| InChI | InChI=1S/C17H13IN4O4S/c18-11-5-9(6-12(15(11)23)22(25)26)7-20-21-8-19-16-14(17(21)24)10-3-1-2-4-13(10)27-16/h5-8,23H,1-4H2/p-1 |
| InChIK | YAIPMYZPEGIJID-UHFFFAOYSA-M |
| TotalMolweight | 495.272 |
| Molweight | 495.272 |
| MonoisotopicMass | 494.962399 |
| CLogP | 1.2768 |
| CLogS | -6.231 |
| H Acceptors | 8 |
| TotalSurfaceArea | 292.05 |
| Relative PSA | 0.3584 |
| PolarSurfaceArea | 142.15 |
| Druglikeness | -3.3817 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-iodo-6-nitro-4-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]phenolate | 2 - 2-iodo-6-nitro-4-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]phenolate