| MolName | 2-(naphthalen-2-ylamino)-N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide |
| MolecularFormula | C21H18N4O3 |
| Smiles | [O-][N+](c1cc(/C=C/C=N\NC(CNc2cc3ccccc3cc2)=O)ccc1)=O |
| InChI | InChI=1S/C21H18N4O3/c26-21(15-22-19-11-10-17-7-1-2-8-18(17)14-19)24-23-12-4-6-16-5-3-9-20(13-16)25(27)28/h1-14,22H,15H2,(H,24,26) |
| InChIK | YANLGYGLBKSIBN-UHFFFAOYSA-N |
| TotalMolweight | 374.399 |
| Molweight | 374.399 |
| MonoisotopicMass | 374.137891 |
| CLogP | 2.7846 |
| CLogS | -5.901 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 296.98 |
| Relative PSA | 0.26227 |
| PolarSurfaceArea | 99.31 |
| Druglikeness | -0.073367 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(naphthalen-2-ylamino)-N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide | 2 - 2-(naphthalen-2-ylamino)-N-[(Z)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide